Introduction：Basic information about CALCIUM LEVULINATE CAS 591-64-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
CALCIUM LEVULINATE Basic information
| Product Name: | CALCIUM LEVULINATE |
| Synonyms: | 4-oxo-pentanoicacicalciumsalt;4-Oxopentanoicacidcalciumsalt;calcium4-oxopentanoate;Calcium-acetopropionate;calciumbis(4-oxovalerate);calcium-diasporal;Calciumlevulate;3-ACETYLPROPIONIC ACID CALCIUM SALT |
| CAS: | 591-64-0 |
| MF: | C10H14CaO6 |
| MW: | 270.29 |
| EINECS: | 209-725-9 |
| Product Categories: | Typical Metal Compounds;Ca (Calcium) Compounds;Classes of Metal Compounds |
| Mol File: | 591-64-0.mol |
|
CALCIUM LEVULINATE Chemical Properties
| Melting point | 123 °C |
| Water Solubility | almost transparency |
| Merck | 1679 |
| InChI | InChI=1S/2C5H8O3.Ca/c2*1-4(6)2-3-5(7)8;/h2*2-3H2,1H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | APKDPOQXVKRLEP-UHFFFAOYSA-L |
| SMILES | [Ca+2].C([O-])(=O)CCC(C)=O.C([O-])(=O)CCC(C)=O |
| LogP | -0.490 (est) |
| CAS DataBase Reference | 591-64-0(CAS DataBase Reference) |
| EPA Substance Registry System | Pentanoic acid, 4-oxo-, calcium salt (591-64-0) |
Safety Information
| WGK Germany | 3 |
| RTECS | SA4000000 |
| TSCA | TSCA listed |
CALCIUM LEVULINATE Usage And Synthesis
| Chemical Properties | White crystal or granular powder |
| Uses | Calcium Levulinate is a salt of Levulinic Acid (L379500), derived from the degredation of cellulose and is a potential precursor to biofuels. Levulinic acid is also a photosensitizer for photodynamic therapy. |
| Uses | Mineral supplement |
CALCIUM LEVULINATE Preparation Products And Raw materials
| Raw materials | Furfuryl alcohol |
