Introduction:Basic information about cis-Terbinafine Hydrochloride CAS 176168-78-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
cis-Terbinafine Hydrochloride Basic information
| Product Name: | cis-Terbinafine Hydrochloride |
| Synonyms: | (2Z)-N,6,6-Trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine hydrochloride;cis-Terbinafine Hydrochloride;(Z)-Terbinafine;N-[(2Z)-6,6-DiMethyl-2-hepten-4-yn-1-yl]-N-Methyl-1-naphthaleneMethanaMine Hydrochloride;Terbinafine Related CoMpound B;Terbinafine Impurity B HCl;(Z)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine,hydrochloride;Terbinafine Related Compound B (25 mg) ((2Z)-N,6,6-Trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine hydrochloride) |
| CAS: | 176168-78-8 |
| MF: | C21H26ClN |
| MW: | 327.89084 |
| EINECS: | |
| Product Categories: | Amines;Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals |
| Mol File: | 176168-78-8.mol |
|
cis-Terbinafine Hydrochloride Chemical Properties
| Melting point | 135 °C(Solv: ethyl acetate (141-78-6)) |
| storage temp. | 2-8°C |
| solubility | Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C21H25N.ClH/c1-21(2,3)15-8-5-9-16-22(4)17-19-13-10-12-18-11-6-7-14-20(18)19;/h5-7,9-14H,16-17H2,1-4H3;1H/b9-5-; |
| InChIKey | BWMISRWJRUSYEX-UYTGOYFPSA-N |
| SMILES | [Cl-].[N+H](Cc1c2c(ccc1)cccc2)(C\C=C/C#CC(C)(C)C)C |
Safety Information
| WGK Germany | WGK 3 |
| HS Code | 2921490002 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
cis-Terbinafine Hydrochloride Usage And Synthesis
| Uses | An impurity in the production of Terbinafine hydrochloride. |
cis-Terbinafine Hydrochloride Preparation Products And Raw materials