Introduction:Basic information about CLOPROSTENOL CAS 40665-92-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
CLOPROSTENOL Basic information
| Product Name: | CLOPROSTENOL |
| Synonyms: | (1-alpha-(z),2-beta-(1e,3r*),3-alpha,5-alpha)-(+-)-yclopentyl);(+)-16-M-CHLOROPHENOXY TETRANOR PROSTAGLANDIN F2ALPHA;(+)-9ALPHA,11ALPHA,15-TRIHYDROXY-16-(3-CHLOROPHENOXY)-17,18,19,20-TETRANOR-PROSTA-5Z,13E-DIEN-1-OIC ACID;(+)-CLOPROSTENOL;CLOPROSTENOL;(Z)-7-[(1S,2S,3S,5R)-2-[(E,3S)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid;VJGGHXVGBSZVMZ-QIZQQNKQSA-N;(Z)-7-[(1S,2S,3S,5R)-2-[(E,3S)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]-5-heptenoic acid |
| CAS: | 40665-92-7 |
| MF: | C22H29ClO6 |
| MW: | 424.92 |
| EINECS: | 255-028-8 |
| Product Categories: | Prostaglandins |
| Mol File: | 40665-92-7.mol |
|
CLOPROSTENOL Chemical Properties
| Boiling point | 535.77°C (rough estimate) |
| density | 1.1217 (rough estimate) |
| refractive index | 1.4429 (estimate) |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 4.76±0.10(Predicted) |
| form | Solid |
| color | Colourless to Yellow |
| InChIKey | VJGGHXVGBSZVMZ-QAAGTRDINA-N |
| SMILES | C(O)(=O)CCC/C=C\C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)COC1=CC=CC(Cl)=C1 |&1:9,10,13,15,18,r| |
| CAS DataBase Reference | 40665-92-7(CAS DataBase Reference) |
Safety Information
CLOPROSTENOL Usage And Synthesis
| Uses | Prostaglandin. |
| Uses | Aryl-oxymethyl analog of prostaglandin F2α. |
| Definition | ChEBI: Cloprostenol is a prostanoid. |
| Brand name | Estrumate(Bayer AnimalHealth). |
| Safety Profile | Experimental reproductive effects. When heated to decomposition it emits toxic fumes of Cl-. |
CLOPROSTENOL Preparation Products And Raw materials