Cupric acetylacetonate CAS 13395-16-9
Introduction：Basic information about Cupric acetylacetonate CAS 13395-16-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Cupric acetylacetonate Basic information
| Product Name: | Cupric acetylacetonate |
| Synonyms: | COPPERACETONYLACETONATE;COPPER ACETYLACETONATE;COPPER(+2)ACETYLACETONATE;COPPER(II) ACETYLACETONATE;COPPER(II) 2,4-PENTANEDIONATE;CUPRIC(II) ACETYLACETONATE;CUPRIC AA;CUPRIC ACETYLACETONATE |
| CAS: | 13395-16-9 |
| MF: | C10H14CuO4 |
| MW: | 261.76 |
| EINECS: | 236-477-9 |
| Product Categories: | Catalysts for Organic Synthesis;Classes of Metal Compounds;Cu (Copper) Compounds;Homogeneous Catalysts;Metal Complexes;Synthetic Organic Chemistry;Pharmaceutical Intermediates;Organometallics;Transition Metal Compounds;metal beta-diketonate complexes;proteins |
| Mol File: | 13395-16-9.mol |
Cupric acetylacetonate Chemical Properties
| Melting point | 284-288 °C (dec.) (lit.) |
| Boiling point | 160 °C (9.7513 mmHg) |
| bulk density | 200-400kg/m3 |
| density | 0.721 g/cm3 |
| vapor pressure | 0.13 hPa (163 °C) |
| Fp | 160°C/10mm |
| storage temp. | Store below +30°C. |
| solubility | 0.2g/l |
| form | Crystalline Powder |
| color | Blue to blue-grayish |
| Specific Gravity | 1.594 |
| Water Solubility | 0.2 g/L (20 ºC) |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Sublimation | 160 ºC |
| BRN | 4157957 |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/2C5H8O2.Cu/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; |
| InChIKey | QYJPSWYYEKYVEJ-FDGPNNRMSA-L |
| SMILES | CC(=O)\C=C(\C)O[Cu]O\C(C)=C/C(C)=O |
| NIST Chemistry Reference | Copper, bis(2,4-pentanedionato-o,o')-(13395-16-9) |
| EPA Substance Registry System | Copper, bis(2,4-pentanedionato-.kappa.O,.kappa.O')-, (SP-4-1)- (13395-16-9) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| RTECS | GL6520000 |
| TSCA | TSCA listed |
| HS Code | 29420000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 13395-16-9(Hazardous Substances Data) |
| Toxicity | LD50 ipr-mus: 19 mg/kg CHTHBK 16,371,71 |
| Chemical Properties | crystalline solid |
| Uses | Copper(II) acetylacetonate catalyzes coupling and carbene transfer reactions. Metal acetylacetonates are used as catalysts for polymerization of olefins and transesterification. They are used as PVC stabilizer. They are used as curing agents for epoxy resins, acrylic adhesives and silicone rubbers. They are used as solvents, lubricant additives, paint drier, and pesticides. They are used in glass coatings. |
| Definition | Crystalline powder, slightly soluble in water andalcohol, soluble in chloroform, mp >230C. Resistant to hydrolysis. A chelating nonionizing compound. |
| reaction suitability | core: copper reagent type: catalyst |
| Safety Profile | Poison by intravenous andintraperitoneal routes. When heated to decomposition it emits acrid smoke andfumes of Cu. |
Cupric acetylacetonate Preparation Products And Raw materials
| Raw materials | Ammonium hydroxide-->Acetylacetone-->Cupric nitrate trihydrate |
| Preparation Products | Aluminum acetylacetonate |
