Introduction：Basic information about Cyclopentylpropionyl chloride CAS 104-97-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Cyclopentylpropionyl chloride Basic information
| Product Name: | Cyclopentylpropionyl chloride |
| Synonyms: | 3-CYCLOPENTYLPROPIONYL CHLORIDE 98+%;3-Cyclopentylpropionic acid chloride;Cyclopentanepropanoic acid chloride;3-Cyclopentanepropionyl chloride;Cyclopentanepropionyl chloride 98%;3-CYCLOPENTYLPROPIONYL CHLORIDE;3-CYCLOPENTYL PROPOYL CHLORIDE;AKOS BBS-00003910 |
| CAS: | 104-97-2 |
| MF: | C8H13ClO |
| MW: | 160.64 |
| EINECS: | 203-257-9 |
| Product Categories: | Acid Halides;Building Blocks;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;Pyridines |
| Mol File: | 104-97-2.mol |
|
Cyclopentylpropionyl chloride Chemical Properties
| Boiling point | 199-200 °C(lit.) |
| density | 1.049 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.464(lit.) |
| Fp | 184 °F |
| form | liquid |
| Sensitive | Moisture Sensitive |
| BRN | 1856952 |
| InChI | InChI=1S/C8H13ClO/c9-8(10)6-5-7-3-1-2-4-7/h7H,1-6H2 |
| InChIKey | SZQVEGOXJYTLLB-UHFFFAOYSA-N |
| SMILES | C1(CCC(Cl)=O)CCCC1 |
| CAS DataBase Reference | 104-97-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Cyclopentylpropionyl chloride(104-97-2) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2914790090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
Cyclopentylpropionyl chloride Usage And Synthesis
| Uses | 3-Cyclopentylpropionyl Chloride is an synthetic intermediate in the synthesis of new family of type 3 17β-Hydroxysteroid dehydrogenase inhibitors. |
| Uses | Cyclopentanepropionyl chloride was used in the synthesis of 3-cyclopentylpropanamido)methylboronic acid. |
Cyclopentylpropionyl chloride Preparation Products And Raw materials
| Preparation Products | Testosterone cypionate-->HYDROCORTISONE CYPIONATE (200 MG)-->Nandrolone cypionate-->4-(5-(3-Cyclopentylpropyl)thiophen-2-yl)butanoic acid-->Cyclopentanepentanoic acid, β-oxo-, ethyl ester |
