Introduction：Basic information about DECYL OLEATE CAS 3687-46-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
DECYL OLEATE Basic information
| Product Name: | DECYL OLEATE |
| Synonyms: | Decyl9-octadecanoate;DECYL OLEATE;9-Octadecenoic acid (9Z)-, decyl ester;9-OCTADECENOICACID(Z)-,DECYLESTER;Decyloleat;(9Z)-9-Octadecenoic acid decyl ester;(Z)-9-Octadecenoic acid decyl ester;Oleic acid decyl ester |
| CAS: | 3687-46-5 |
| MF: | C28H54O2 |
| MW: | 422.73 |
| EINECS: | 222-981-6 |
| Product Categories: | |
| Mol File: | 3687-46-5.mol |
|
DECYL OLEATE Chemical Properties
| Melting point | 2.8 °C |
| Boiling point | 494.8±24.0 °C(Predicted) |
| density | 0.862 g/cm3 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Practically insoluble in water, miscible with ethanol (96 per cent), with methylene chloride and with light petroleum (bp: 40-60 °C). |
| form | Oil |
| color | Colourless |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT
SKIN CONDITIONING |
| Cosmetic Ingredient Review (CIR) | DECYL OLEATE (3687-46-5) |
| InChI | InChI=1S/C28H54O2/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-22-24-26-28(29)30-27-25-23-21-12-10-8-6-4-2/h15-16H,3-14,17-27H2,1-2H3/b16-15- |
| InChIKey | SASYSVUEVMOWPL-NXVVXOECSA-N |
| SMILES | C(OCCCCCCCCCC)(=O)CCCCCCC/C=C\CCCCCCCC |
| LogP | 12.44 |
| EPA Substance Registry System | Decyl oleate (3687-46-5) |
Safety Information
DECYL OLEATE Usage And Synthesis
| Chemical Properties | Clear, pale yellow or colourless liquid. |
| Uses | Decyl Oleate is an emollient used in cosmetics and moisturizing industries. |
| Uses | Excipient. |
| Definition | ChEBI: A wax ester obtained by the formal condensation of the carboxy group of oleic acid with the hydroxy group of decanol. |
DECYL OLEATE Preparation Products And Raw materials
