Introduction：Basic information about DIBUTYL ITACONATE CAS 2155-60-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
DIBUTYL ITACONATE Basic information
| Product Name: | DIBUTYL ITACONATE |
| Synonyms: | Butanedioic acid, methylene-, dibutyl ester;Butanedioicacid,methylene-,dibutylester;Dibutyl 2-methylenesuccinate;methylene-butanedioicacidibutylester;Succinic acid, methylene-, dibutyl ester;DIBUTYL METHYLENESUCCINATE;DIBUTYL ITACONATE;DI-N-BUTYL ITACONATE |
| CAS: | 2155-60-4 |
| MF: | C13H22O4 |
| MW: | 242.31 |
| EINECS: | 218-451-9 |
| Product Categories: | Polymer Additives;Plasticizers;Polymer Science |
| Mol File: | 2155-60-4.mol |
|
DIBUTYL ITACONATE Chemical Properties
| Boiling point | 284 °C(lit.) |
| density | 0.985 g/mL at 25 °C(lit.) |
| vapor pressure | 0.19Pa at 25℃ |
| refractive index | n20/D 1.444(lit.) |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.985 |
| Water Solubility | 74.8mg/L at 20℃ |
| InChI | InChI=1S/C13H22O4/c1-4-6-8-16-12(14)10-11(3)13(15)17-9-7-5-2/h3-10H2,1-2H3 |
| InChIKey | OGVXYCDTRMDYOG-UHFFFAOYSA-N |
| SMILES | C(OCCCC)(=O)C(=C)CC(OCCCC)=O |
| LogP | 3.8 at 20℃ |
| CAS DataBase Reference | 2155-60-4(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, methylene-, dibutyl ester (2155-60-4) |
Safety Information
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29171900 |
| Storage Class | 10 - Combustible liquids |
DIBUTYL ITACONATE Usage And Synthesis
| Uses | DBI is a monomer that can be copolymerized with pyridine groups to form nanocomposites for the development of bio-based elastomers. Copolymerization of DBI with acrylated epoxidized soya oil (AESO) can produce a thermoset material which finds potential applications in the modification of fatty acids. |
| General Description | Dibutyl itaconate (DBI) is an itaconate ester that can be prepared by an itaconic acid precursor. |
| Flammability and Explosibility | Not classified |
DIBUTYL ITACONATE Preparation Products And Raw materials
| Raw materials | 2-Methylenesuccinic acid hydrogen 1-butyl ester-->ITACONIC ACID MONO-N-BUTYL ESTER-->1-Butanol-->Itaconic anhydride-->Itaconic acid |
