Introduction：Basic information about DibutylCarbamodithioic acid sodium salt CAS 136-30-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
DibutylCarbamodithioic acid sodium salt Basic information
| Product Name: | DibutylCarbamodithioic acid sodium salt |
| Synonyms: | sodium,N,N-dibutylcarbamodithioate;SDBC;SODIUM DI-N-BUTYLDITHIOCARBAMATE;SODIUM DIBUTYLDITHIOCARBAMATE;TEPIDON;acceltp;butylnamate;Carbamodithioicacid,dibutyl-,sodiumsalt |
| CAS: | 136-30-1 |
| MF: | C9H18NNaS2 |
| MW: | 227.37 |
| EINECS: | 205-238-0 |
| Product Categories: | |
| Mol File: | 136-30-1.mol |
|
DibutylCarbamodithioic acid sodium salt Chemical Properties
| density | 1,09 g/cm3 |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| Specific Gravity | 1.09 |
| Appearance | Light yellow to green yellow Liquid |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/C9H19NS2.Na/c1-3-5-7-10(9(11)12)8-6-4-2;/h3-8H2,1-2H3,(H,11,12);/q;+1/p-1 |
| InChIKey | HUMLQUKVJARKRN-UHFFFAOYSA-M |
| SMILES | N(C([S-])=S)(CCCC)CCCC.[Na+] |
| CAS DataBase Reference | 136-30-1(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium dibutyldithiocarbamate (136-30-1) |
Safety Information
| Hazard Codes | T,C,N |
| Risk Statements | 36/37/38-50-34-24-22 |
| Safety Statements | 26-36/37/39-61-45 |
| TSCA | TSCA listed |
| Hazardous Substances Data | 136-30-1(Hazardous Substances Data) |
DibutylCarbamodithioic acid sodium salt Usage And Synthesis
| Uses | Sodium DBDT can be used for heavy metal wastewater treatment agent. |
| Flammability and Explosibility | Non flammable |
| Safety Profile | Poison by intraperitoneal route. When heated to decomposition it emits very toxic fumes of NOx, SOx, and NazO. See also CARBAMATES |
DibutylCarbamodithioic acid sodium salt Preparation Products And Raw materials
| Preparation Products | Nickel dibutyldithiocarbamate |
