Introduction：Basic information about Diisobutyldimethoxysilane CAS 17980-32-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Diisobutyldimethoxysilane Basic information
| Product Name: | Diisobutyldimethoxysilane |
| Synonyms: | DIISOBUTYLDIMETHOXYSILANE;dimethoxybis(2-methylpropyl)-silan;dimethoxybis(2-methylpropyl)-Silane;Silane, dimethoxybis(2-methylpropyl)-;Diisobutyldimethoxysilan;Diisobutyl DiMethoxy Silane (DIBMS);DIISOBUTYLDIMETHOXYSILANE FOR SYNTHESIS;Diisobutyldimethoxysilane > |
| CAS: | 17980-32-4 |
| MF: | C10H24O2Si |
| MW: | 204.38 |
| EINECS: | 605-870-0 |
| Product Categories: | |
| Mol File: | 17980-32-4.mol |
|
Diisobutyldimethoxysilane Chemical Properties
| Melting point | <-78°C |
| Boiling point | 120 °C |
| density | 0.87 |
| vapor pressure | 0.75 hPa ( 25 °C) |
| refractive index | 1.4235-1.4255 |
| Fp | 76°C |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.87 |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2636371 |
| InChI | 1S/C10H24O2Si/c1-9(2)7-13(11-5,12-6)8-10(3)4/h9-10H,7-8H2,1-6H3 |
| InChIKey | NHYFIJRXGOQNFS-UHFFFAOYSA-N |
| SMILES | [Si](OC)(OC)(CC(C)C)CC(C)C |
| CAS DataBase Reference | 17980-32-4(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, dimethoxybis(2-methylpropyl)- (17980-32-4) |
Safety Information
| Risk Statements | 51/53-36/38 |
| Safety Statements | 36/37/39-45-26/36 |
| RIDADR | 3082 |
| WGK Germany | WGK 2 |
| Autoignition Temperature | 255°C |
| TSCA | TSCA listed |
| HazardClass | 9 |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 |
Diisobutyldimethoxysilane Usage And Synthesis
| Uses | Diisobutyldimethoxysilane is a colorless, transparent liquid used as a catalyst in propylene polymerization. |
Diisobutyldimethoxysilane Preparation Products And Raw materials
