Introduction：Basic information about Dimercaptosuccinic acid CAS 2418-14-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Dimercaptosuccinic acid Basic information
| Product Name: | Dimercaptosuccinic acid |
| Synonyms: | 2,3-dimercapto-butanedioicaci;2,3-dimercaptobutanedioicacid;2,2-Dimercaptosuccinic acid;2,3-dimercapto-succinicaci;alpha,beta-dimercaptosuccinicacid;suximer;2,3-DIMERCAPTOSUCCINIC ACID;DIMERCAPTOSUCCINIC ACID |
| CAS: | 2418-14-6 |
| MF: | C4H6O4S2 |
| MW: | 182.22 |
| EINECS: | 219-334-5 |
| Product Categories: | bc0001 |
| Mol File: | 2418-14-6.mol |
|
Dimercaptosuccinic acid Chemical Properties
| Melting point | 196-198°C |
| Boiling point | 285.62°C (rough estimate) |
| density | 1.439 (estimate) |
| refractive index | 1.5220 (estimate) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Methanol (Slightly) |
| pka | 2.74±0.25(Predicted) |
| form | Solid |
| color | White to Off-White |
| Stability: | Air Sensitive, Stench, Unstable in DMSO |
| InChI | InChI=1S/C4H6O4S2/c5-3(6)1(9)2(10)4(7)8/h1-2,9-10H,(H,5,6)(H,7,8) |
| InChIKey | ACTRVOBWPAIOHC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(S)C(S)C(O)=O |
| CAS DataBase Reference | 2418-14-6(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, 2,3-dimercapto- (2418-14-6) |
Safety Information
Dimercaptosuccinic acid Usage And Synthesis
| Uses | 2,3-Dimercaptosuccinic Acid is used as a chelator in the treatment of mercury and lead poisonings. |
Dimercaptosuccinic acid Preparation Products And Raw materials
| Raw materials | Thioacetic acid-->Acetylenedicarboxylic acid |
