Introduction：Basic information about ETHANOL-D6 CAS 1516-08-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
ETHANOL-D6 Basic information
| Product Name: | ETHANOL-D6 |
| Synonyms: | ETHANOL-D6;ETHYL ALCOHOL-D6;ETHYL-D5 ALCOHOL-D;HEXADEUTEROETHANOL;EthanolD6>99%2x1ml;EthanolD6>99%1x5ml;[2H6]ethanol;ETHANOL-D6 100 ATOM % D |
| CAS: | 1516-08-1 |
| MF: | C2D6O |
| MW: | 52.11 |
| EINECS: | 216-162-2 |
| Product Categories: | Additional NMR Solvents;Aldrich High Purity NMR Solvents for Routine NMR;Alphabetical Listings;E-F;High Throughput NMR;Labware;NMR;NMR Solvents;NMR Solvents and Reagents;Routine NMR;Solvent by Application;Solvents;Solvents for High Throughput NMR;Spectroscopy Solvents (IR;Stable Isotopes;Tubes and Accessories;UV/Vis) |
| Mol File: | 1516-08-1.mol |
|
ETHANOL-D6 Chemical Properties
| Melting point | -114,1°C |
| Melting point | -130 °C(lit.) |
| Boiling point | 78 °C(lit.) |
| Boiling point | 78,5°C |
| density | 0.892 g/mL at 25 °C |
| density | d = 0,89 |
| refractive index | n20/D 1.358(lit.) |
| Fp | 48 °F |
| storage temp. | Flammables area |
| solubility | All Organic Solvents |
| form | Liquid |
| color | Colorless |
| Specific Gravity | 0.91 |
| explosive limit | 3.5-15%(V)(ethanol) |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 1699096 |
| Stability: | Volatile |
| InChI | 1S/C2H6O/c1-2-3/h3H,2H2,1H3/i1D3,2D2,3D |
| InChIKey | LFQSCWFLJHTTHZ-LIDOUZCJSA-N |
| SMILES | [2H]OC([2H])([2H])C([2H])([2H])[2H] |
| CAS DataBase Reference | 1516-08-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 7-16-2017/7/16 |
| RIDADR | UN 1170 3/PG 2 |
| WGK Germany | 1 |
| Autoignition Temperature | 425 °C (ethanol) |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2
Flam. Liq. 2 |
| Toxicity | LD50 orally in Rabbit: 6200 mg/kg |
ETHANOL-D6 Usage And Synthesis
| Chemical Properties | clear colorless liquid |
| Uses | Ethanol-d_6, is employed as an NMR solvent. It is used as pharmaceutical intermediate. |
| Definition | ChEBI: Ethanol-d6 is a deuterated compound, a volatile organic compound, an alkyl alcohol and a member of ethanols. |
| General Description | Ethanol-d6 is a deuterated derivative of ethanol. It has an isotopic purity of 99.5atom%D. It is a standard purity solvent suitable for routine NMR analyses (conducted at ambient temperatures where quality is less critical). |
ETHANOL-D6 Preparation Products And Raw materials
| Preparation Products | ethylphenidate-->ETHYLENE-D4-->IODOETHANE-D5 |
