Introduction：Basic information about ethenyl-tri(propan-2-yl)silane CAS 121675-48-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
ethenyl-tri(propan-2-yl)silane Basic information
| Product Name: | ethenyl-tri(propan-2-yl)silane |
| Synonyms: | ethenyl-tri(propan-2-yl)silane;Silane, ethenyltris(1-methylethyl)-;1-Triisopropylsilyl-1-Ethene;DKFELEX0271;Vinyltri(propane-2-yl)silane |
| CAS: | 121675-48-7 |
| MF: | C11H24Si |
| MW: | 184.39 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 121675-48-7.mol |
|
ethenyl-tri(propan-2-yl)silane Chemical Properties
| InChI | InChI=1S/C11H24Si/c1-8-12(9(2)3,10(4)5)11(6)7/h8-11H,1H2,2-7H3 |
| InChIKey | CJCLDCFGJRZTSP-UHFFFAOYSA-N |
| SMILES | [Si](C=C)(C(C)C)(C(C)C)C(C)C |
Safety Information
ethenyl-tri(propan-2-yl)silane Usage And Synthesis
| Uses | Ethenyltri(propan-2-yl)silane is an organosilicon compound that can be used as a raw material for organic synthesis to prepare siloxane compounds. |
ethenyl-tri(propan-2-yl)silane Preparation Products And Raw materials
