Introduction：Basic information about Ethyl (S)-2-[(S)-4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl]-4-phenylbutyrate CAS 84793-24-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Ethyl (S)-2-[(S)-4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl]-4-phenylbutyrate Basic information
| Product Name: | Ethyl (S)-2-[(S)-4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl]-4-phenylbutyrate |
| Synonyms: | N-[1-(S)-ETHOXYCARBONYL-3-PHENYLPROPYL]-N-CARBOXY-L-ALANINE ANHYDRIDE (NEPA-NCA);ECPPA-NCA;ENALAPRIL MALEATE INTERMEDIATES;N-(1-(S)-(+)-ETHOXYCARBONYL-3-PHENYLPRO&;N-[1-(S)-ETHOXYCARBONYL-3-PHENYLPROPYL]-L-ALANINE -N-CARBOXYANHYDRIDE(INTERMEDIATE OF ENALAPRIL);n-[1-(s)-(ethoxycarbonyl)-3-phenylpropyl]-1-alanylcarboxy anhydride;N-(1-(S)-Ethoxy Carbonyl-3-Phenylpropyl)-L-Alanine-N-carboxyanhydried;EPAL-carboxanhydride |
| CAS: | 84793-24-8 |
| MF: | C16H19NO5 |
| MW: | 305.33 |
| EINECS: | 212-344-0 |
| Product Categories: | (intermediates of enalapril);Alanine Derivatives;Peptide Synthesis;Unnatural Amino Acid Derivatives |
| Mol File: | 84793-24-8.mol |
|
Ethyl (S)-2-[(S)-4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl]-4-phenylbutyrate Chemical Properties
| Melting point | 69-73 °C(lit.) |
| alpha | 36.5 º (c=1, CHCl3) |
| Boiling point | 414.8±55.0 °C(Predicted) |
| density | 1.223±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| pka | -2.40±0.40(Predicted) |
| Optical Rotation | [α]20/D +36.5°, c = 1 in chloroform |
| BRN | 5608080 |
| Major Application | peptide synthesis |
| InChI | 1S/C16H19NO5/c1-3-21-15(19)13(10-9-12-7-5-4-6-8-12)17-11(2)14(18)22-16(17)20/h4-8,11,13H,3,9-10H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | GFZFELCFSBCPDB-AAEUAGOBSA-N |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N2[C@@H](C)C(=O)OC2=O |
| CAS DataBase Reference | 84793-24-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43-41 |
| Safety Statements | 22-24/25-36-26-37/39-24 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1
Skin Sens. 1 |
Ethyl (S)-2-[(S)-4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl]-4-phenylbutyrate Usage And Synthesis
| Chemical Properties | White powder |
| Uses | N-[1-(S)-Ethoxycarbonyl-3-phenylpropyl]-L-alanine-N-carboxyanhydride is an impurity of Enalapril (E555250), an?antihypertensive and an angiotensin-converting enzyme (ACE) inhibitor. |
| reaction suitability | reaction type: solution phase peptide synthesis |
Ethyl (S)-2-[(S)-4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl]-4-phenylbutyrate Preparation Products And Raw materials
| Preparation Products | Ramipril-->(2R,3aR,6aR)-Ramipril-->N-[(S)-(+)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanine |
