Introduction：Basic information about Ethylmethyldichlorosilane CAS 4525-44-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Ethylmethyldichlorosilane Basic information
| Product Name: | Ethylmethyldichlorosilane |
| Synonyms: | ETHYLMETHYLDICHLOROSILANE;DICHLOROETHYLMETHYLSILANE;dichloroethylmethyl-silan;Ethyldichloromethylsilane~Ethylmethyldichlorosilane;Silane, dichloroethylmethyl-;ethyldichloromethylsilane;Methylethyldichlorosilane;ETHYLMETHYLDICHLOROSILANE 97% MIN |
| CAS: | 4525-44-4 |
| MF: | C3H8Cl2Si |
| MW: | 143.09 |
| EINECS: | 224-860-3 |
| Product Categories: | |
| Mol File: | 4525-44-4.mol |
|
Ethylmethyldichlorosilane Chemical Properties
| Melting point | 8°C |
| Boiling point | 100 °C(lit.) |
| density | 1.063 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.419(lit.) |
| Fp | 54 °F |
| Specific Gravity | 1.063 |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 1361374 |
| InChI | InChI=1S/C3H8Cl2Si/c1-6-2-3(4)5/h3H,2,6H2,1H3 |
| InChIKey | BYKDIAHBFKIHHS-UHFFFAOYSA-N |
| SMILES | [SiH2](CC(Cl)Cl)C |
| CAS DataBase Reference | 4525-44-4(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, dichloroethylmethyl- (4525-44-4) |
Safety Information
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 16-26-28-36/37/39-45 |
| RIDADR | UN 2985 3/PG 2 |
| WGK Germany | 1 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1
Flam. Liq. 2
Skin Corr. 1B |
Ethylmethyldichlorosilane Usage And Synthesis
| Chemical Properties | colorless liquid |
| Uses | Ethylmethyldichlorosilane is the raw material for producing silicone rubber and silicone resin. Silicone resins has many advantages over natural rubber. |
Ethylmethyldichlorosilane Preparation Products And Raw materials
