Introduction：Basic information about Fluoroglycofen-ethyl CAS 77501-90-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Fluoroglycofen-ethyl Basic information
| Product Name: | Fluoroglycofen-ethyl |
| Synonyms: | FLUOROGLYCOFEN-ETHYL;COMPETE;Fluoroglyofene;Fluroglycofen;carboxymethyl-5-(2-chloro-4-(trifluorometnyl)phenoxy)-2-nitrobenzoate;O-(5-(2-chloro-α,α,α-trifluoro-p-tolyloxy)-2-nitrobenzoyl)glycolic acid;lglycolate;rh-0265 |
| CAS: | 77501-90-7 |
| MF: | C18H13ClF3NO7 |
| MW: | 447.75 |
| EINECS: | |
| Product Categories: | Diphenyl etherPesticides&Metabolites;Alpha sort;E-GAlphabetic;F;FA - FL;Herbicides;Pesticides&Metabolites |
| Mol File: | 77501-90-7.mol |
|
Fluoroglycofen-ethyl Chemical Properties
| Melting point | 65 °C |
| Boiling point | 487.7±45.0 °C(Predicted) |
| density | 1.4996 (estimate) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Yellow to Light Beige |
| Water Solubility | 604ug/L(temperature not stated) |
| InChI | InChI=1S/C18H13ClF3NO7/c1-2-28-16(24)9-29-17(25)12-8-11(4-5-14(12)23(26)27)30-15-6-3-10(7-13(15)19)18(20,21)22/h3-8H,2,9H2,1H3 |
| InChIKey | IPPAUTOBDWNELX-UHFFFAOYSA-N |
| SMILES | C(OCC(OCC)=O)(=O)C1=CC(OC2=CC=C(C(F)(F)F)C=C2Cl)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 77501-90-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Fluoroglycofen ethyl ester(77501-90-7) |
| EPA Substance Registry System | Fluoroglycofen-ethyl (77501-90-7) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-52/53 |
| Safety Statements | 61 |
| RTECS | DG5643100 |
| HS Code | 29189900 |
Fluoroglycofen-ethyl Usage And Synthesis
| Uses | Fluoroglycofen-ethyl can be used in biological study and agricultural use of pesticide for removing root of Alternanthera philoxeroides. |
Fluoroglycofen-ethyl Preparation Products And Raw materials
