Introduction：Basic information about FMOC-L-3-Trifluoromethylphe CAS 205526-27-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
FMOC-L-3-Trifluoromethylphe Basic information
| Product Name: | FMOC-L-3-Trifluoromethylphe |
| Synonyms: | (2S)-2-[[9H-fluoren-9-ylmethoxy(oxo)methyl]amino]-3-[3-(trifluoromethyl)phenyl]propanoic acid;3-(Trifluoromethyl)-L-phenylalanine, N-FMOC protected 95+%;FMOC PROTECTED;Fmoc-L-3-CF3-Phe;N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-(trifluoromethyl)-L-phenylalanine;(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-[3-(trifluoromethyl)phenyl]propanoic acid;fluorenylmethoxycarbonyl-l-3-trifluoromethylphenylalanine;FMOC-3-(TRIFLUOROMETHYL)-L-PHENYLALANINE |
| CAS: | 205526-27-8 |
| MF: | C25H20F3NO4 |
| MW: | 455.43 |
| EINECS: | |
| Product Categories: | Phenylalanine analogs and other aromatic alpha amino acids;a-amino;Amino Acids |
| Mol File: | 205526-27-8.mol |
|
FMOC-L-3-Trifluoromethylphe Chemical Properties
| Melting point | 147-157°C |
| Boiling point | 611.2±55.0 °C(Predicted) |
| density | 1.351±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.68±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChIKey | AJMRBDCOLBEYRZ-QFIPXVFZSA-N |
| SMILES | OC(=O)[C@H](Cc1cccc(c1)C(F)(F)F)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 205526-27-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
FMOC-L-3-Trifluoromethylphe Usage And Synthesis
| Chemical Properties | White to off-white powder |
| Uses | peptide synthesis |
| General Description | may contain ~10% (w/w) solvent |
| reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
FMOC-L-3-Trifluoromethylphe Preparation Products And Raw materials
