Introduction:Basic information about Isooctyl palmitate CAS 1341-38-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Isooctyl palmitate Basic information
| Product Name: | Isooctyl palmitate |
| Synonyms: | ISOOCTYL PALMITATE;Isooctyl hexadecanoate;Palmitic acid, 6-methylheptyl ester;Palmitic acid 2-ethylhexyl ester;6-methylheptyl hexadecanoate;PalMitic acid isooctyl;2-EHP;Isooctyl palmitate ISO 9001:2015 REACH |
| CAS: | 1341-38-4 |
| MF: | C24H48O2 |
| MW: | 368.64 |
| EINECS: | 215-675-9 |
| Product Categories: | Cosmetics;bc0001 |
| Mol File: | 1341-38-4.mol |
|
Isooctyl palmitate Chemical Properties
| Boiling point | 394.5-398.6℃ at 102.15kPa |
| density | 0.855g/cm3 at 20℃ |
| vapor pressure | 0.016Pa at 20℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| InChI | InChI=1S/C24H48O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-18-21-24(25)26-22-19-16-17-20-23(2)3/h23H,4-22H2,1-3H3 |
| InChIKey | CJSPFDQEYQBDNN-UHFFFAOYSA-N |
| SMILES | C(=O)(CCCCCCCCCCCCCCC)OCCCCCC(C)C |
| LogP | 3.763 at 25℃ and pH5.97 |
| CAS DataBase Reference | 1341-38-4(CAS DataBase Reference) |
Safety Information
Isooctyl palmitate Usage And Synthesis
| Chemical Properties | Clear liquid.Soluble in most organicsolvents. Combustible. |
| Uses | Secondary plasticizer for synthetic resins,extrusion aid and plasticizer. |
Isooctyl palmitate Preparation Products And Raw materials