Introduction：Basic information about Lambda Cyhalotric Acid CAS 72748-35-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Lambda Cyhalotric Acid Basic information
| Product Name: | Lambda Cyhalotric Acid |
| Synonyms: | (1R,3R)-rel-3-(2-Chloro-3,3,3-trifluoro-1-propenyl)-2,2-diMethyl-cyclopropanecarboxylic Acid;cis-3-(2-Chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-diMethylcyclopropanecarboxylic acid;2-diMethylcyclopropane carboxylate acid;Trifluoroacetic acid ju;cis-3-[(2-Chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropanecarboxylic acid;Z-(1R,S)-cis-2,2-dimethyl-3-(2,2-chloro-3,3,3-trifluoro-1-propenyl)cyclopropanecarboxylic acid;BIFENTHRIN ACID;BIFENTHRIN ACID METABOLITE |
| CAS: | 72748-35-7 |
| MF: | C9H10ClF3O2 |
| MW: | 242.62 |
| EINECS: | 266-275-6 |
| Product Categories: | Intermediates;Miscellaneous Reagents;Pesticide;3 |
| Mol File: | 72748-35-7.mol |
|
Lambda Cyhalotric Acid Chemical Properties
| Melting point | 107-109°C |
| Boiling point | 271.6±40.0 °C(Predicted) |
| density | 1.152 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Sparingly, Sonicated), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.91±0.42(Predicted) |
| color | White to Off-White |
| InChI | InChI=1/C9H10ClF3O2/c1-8(2)4(6(8)7(14)15)3-5(10)9(11,12)13/h3-4,6H,1-2H3,(H,14,15)/t4-,6-/s3 |
| InChIKey | SPVZAYWHHVLPBN-BNFWCSRPNA-N |
| SMILES | [C@@H]1(C(O)=O)[C@H](C=C(Cl)C(F)(F)F)C1(C)C |&1:0,4,r| |
| CAS DataBase Reference | 72748-35-7(CAS DataBase Reference) |
Safety Information
Lambda Cyhalotric Acid Usage And Synthesis
| Chemical Properties | Z-(1R,S)-cis-2,2-dimethyl-3-(2,2-chloro-3,3,3-trifluoro-1-propenyl)cyclopropanecarboxylic acid is Off-White Solid |
| Uses | Z-(1R,S)-cis-2,2-dimethyl-3-(2,2-chloro-3,3,3-trifluoro-1-propenyl)cyclopropanecarboxylic acid used in the synthesis of cyhalothric pesticides and fungicides. |
| Uses | Reagent used in the synthesis of cyhalothric pesticides and fungicides. |
| storage | Store at 4° C |
Lambda Cyhalotric Acid Preparation Products And Raw materials
| Raw materials | METHYL 3-(2,2-DICHLOROVINYL)-2,2-DIMETHYL-(1-CYCLOPROPANE)CARBOXYLATE-->Trifluoropropene |
| Preparation Products | Z-cis-3-(2-chloro-3，3，3-trifluoro-1-propenyl)-2，2-dimethylcyclopropane carbonyl chloride |
