Introduction：Basic information about L-METHIONINE SULFONE CAS 7314-32-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
L-METHIONINE SULFONE Basic information
| Product Name: | L-METHIONINE SULFONE |
| Synonyms: | 2-amino-4-mesyl-butyric acid;2-amino-4-methylsulfonylbutanoic acid;2-azanyl-4-methylsulfonyl-butanoic acid;L-Methionine sulfone,L-2-Amino-4-(methylsulfonyl)butanoic acid;L-METHIONINE SULFONE (1-13C);L-Met(O2)-OH;L-Methionine sulfone≥ 98% (Titration);L-2-AMINO-4-[METHYLSULFONYL]BUTANOIC ACID |
| CAS: | 7314-32-1 |
| MF: | C5H11NO4S |
| MW: | 181.21 |
| EINECS: | 230-774-7 |
| Product Categories: | |
| Mol File: | 7314-32-1.mol |
|
L-METHIONINE SULFONE Chemical Properties
| Melting point | ~275 °C (dec.) |
| Boiling point | 450.5±40.0 °C(Predicted) |
| density | 1.385±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Sparingly), Water (Sparingly, Heated, Sonicated) |
| pka | 2.10±0.10(Predicted) |
| form | Powder |
| color | White to off-white |
| BRN | 1725510 |
| Major Application | detection
peptide synthesis |
| InChI | 1S/C5H11NO4S/c1-11(9,10)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | UCUNFLYVYCGDHP-BYPYZUCNSA-N |
| SMILES | CS(=O)(=O)CC[C@H](N)C(O)=O |
| CAS DataBase Reference | 7314-32-1(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
L-METHIONINE SULFONE Usage And Synthesis
| Chemical Properties | Crystalline |
| Uses | L-Methionine Sulfone is an impurity of L-Methionine (M260440) which is an essential aminoacid for human development. L-Methionine is a hepatoprotectant, an antidote (acetominophen poisoning) and a urinary acidifier. |
| Definition | ChEBI: A methionine derivative where the sulphur is oxidised to a sulphone. |
| Biochem/physiol Actions | L-Methionine sulfone may be used to study pupae development of the silkworm Bombyx mori L. L-Methionine sulfone may be used as a complexing agent to study conformational structures and stereospecificity of enzymes such as glutamate synthase and gamma-glutamyl transpeptidase. |
| in vivo | L-Methionine sulfone cannot be utilized by the weanling rat[1]. |
L-METHIONINE SULFONE Preparation Products And Raw materials
