Introduction：Basic information about L-NORLEUCINOL CAS 80696-29-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
L-NORLEUCINOL Basic information
| Product Name: | L-NORLEUCINOL |
| Synonyms: | (S)-(+)-2-AMINO-1-HEXANOL;(S)-2-AMINO-1-HEXANOL;L-NORLEUCINOL;(S)-2-Amino-1-hexzanol;(2S)-2-Amino-1-hexanol;(S)-2-Amino-1-hexanol HCl;(2S)-2-aminohexan-1-ol;(S)-2-aminohexan-1-ol |
| CAS: | 80696-29-3 |
| MF: | C6H15NO |
| MW: | 117.19 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 80696-29-3.mol |
|
L-NORLEUCINOL Chemical Properties
| Melting point | 35-40 °C(lit.) |
| Boiling point | 216-218 °C(lit.) |
| Fp | 211 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Aqueous Acid (Slightly), Chloroform (Slightly, Sonicated), DMSO (Slightly) |
| form | Solid |
| color | White to Pale Yellow |
| Optical Rotation | [α]20/D +14°, c = 1 in chloroform |
| InChI | InChI=1S/C6H15NO/c1-2-3-4-6(7)5-8/h6,8H,2-5,7H2,1H3/t6-/m0/s1 |
| InChIKey | DPEOTCPCYHSVTC-LURJTMIESA-N |
| SMILES | C(O)[C@@H](N)CCCC |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2922190090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
L-NORLEUCINOL Usage And Synthesis
| Uses | L-Norleucinol is used as a reactant in the synthesis of novel pyrimidine TLR7/8 dual agonists to treat hepatitis B. |
| Uses | (S)-(+)-2-Amino-1-hexanol can be used in one of the key synthetic steps for the synthesis of house dust mite (HDM) peptidase allergen Der p 1 inhibitors. |
L-NORLEUCINOL Preparation Products And Raw materials
| Preparation Products | CALPEPTIN |
