Introduction：Basic information about N-(4-Aminobutyl)-N-ethylisoluminol CAS 66612-29-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-(4-Aminobutyl)-N-ethylisoluminol Basic information
| Product Name: | N-(4-Aminobutyl)-N-ethylisoluminol |
| Synonyms: | ABEI;6-[N-(4-AMINOBUTYL)-N-ETHYLAMINO]-2,3-DIHYDRO-1,4-PHTHALAZINEDIONE;6-[N-(4-AMINOBUTYL)-N-ETHYLAMINO]-2,3-DIHYDROPHTHALAZINE-1,4-DIONE;4-(N1-ETHYL-4-AMINOBUTYLAMINO)PHTHALIC HYDRAZIDE;N-(4-AMINOBUTYL)-N-ETHYLISOLUMINOL;(4-Aminobutyl)-N-Ethyl-Isoluminol;ABEIN;N-(4-AMINOBUTYL)-N-ETHYLISOLUMINOL FOR & |
| CAS: | 66612-29-1 |
| MF: | C14H20N4O2 |
| MW: | 276.33 |
| EINECS: | |
| Product Categories: | Chemiluminescence Detection (HPLC Labeling Reagents);Electronic Chemicals;Analytical Chemistry;Chemiluminescence;HPLC Labeling Reagents;Luminols (Chemiluminescence) |
| Mol File: | 66612-29-1.mol |
|
N-(4-Aminobutyl)-N-ethylisoluminol Chemical Properties
| Melting point | 259-260 °C (lit.) |
| density | 1.206±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | glacial acetic acid: 50mg/mL, clear, colorless to yellow |
| form | powder to crystal |
| pka | 10.83±0.20(Predicted) |
| color | White to Light yellow |
| BRN | 920895 |
| InChI | 1S/C14H20N4O2/c1-2-18(8-4-3-7-15)10-5-6-11-12(9-10)14(20)17-16-13(11)19/h5-6,9H,2-4,7-8,15H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | LEOJISUPFSWNMA-UHFFFAOYSA-N |
| SMILES | CCN(CCCCN)c1ccc2C(=O)NNC(=O)c2c1 |
| CAS DataBase Reference | 66612-29-1(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
N-(4-Aminobutyl)-N-ethylisoluminol Usage And Synthesis
| Chemical Properties | White to light yellow powder to crystal |
| Uses | ABEI is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Definition | ChEBI: ABEI is a member of phthalazines. |
N-(4-Aminobutyl)-N-ethylisoluminol Preparation Products And Raw materials
| Preparation Products | DIHYDROLIPOIC ACID |
