Introduction：Basic information about N-(Carboxymethyl)-N-(phosphonomethyl)-glycine CAS 5994-61-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-(Carboxymethyl)-N-(phosphonomethyl)-glycine Basic information
| Product Name: | N-(Carboxymethyl)-N-(phosphonomethyl)-glycine |
| Synonyms: | n-(phosphonomethyl)iminodiaceticacidhydrate;n-(carboxymethyl)-n-(phosphonomethyl)-glycine;N-(PHOSPHONOMETHYL)IMINODIACETIC ACID;N-(PHOSPHONOMETHYL)IMINODIACETIC ACID MONOHYDRATE;PMIDA;N-Phosphonomethyl aminodiacetic acid;PMID;N-(PHOSPHONOMETHYL)IMINODIACETIC ACID, 9 5% |
| CAS: | 5994-61-6 |
| MF: | C5H10NO7P |
| MW: | 227.11 |
| EINECS: | 227-824-5 |
| Product Categories: | Organic Building Blocks;Phosphonic/Phosphinic Acids;Phosphorus Compounds |
| Mol File: | 5994-61-6.mol |
|
N-(Carboxymethyl)-N-(phosphonomethyl)-glycine Chemical Properties
| Melting point | 215 °C (dec.)(lit.) |
| Boiling point | 585.9±60.0 °C(Predicted) |
| density | 1.792±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 45℃ |
| storage temp. | RT, protect from light |
| solubility | Aqueous Base (Slightly), Methanol (Slightly) |
| pka | 0.90±0.10(Predicted) |
| form | Crystalline |
| Appearance | White to off-white Solid |
| BRN | 1795744 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C5H10NO7P/c7-4(8)1-6(2-5(9)10)3-14(11,12)13/h1-3H2,(H,7,8)(H,9,10)(H2,11,12,13) |
| InChIKey | AZIHIQIVLANVKD-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CN(CC(O)=O)CP(O)(O)=O |
| CAS DataBase Reference | 5994-61-6(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphonomethyliminodiacetic acid (5994-61-6) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1
STOT SE 3 |
N-(Carboxymethyl)-N-(phosphonomethyl)-glycine Usage And Synthesis
| Uses | N-(Carboxymethyl)-N-(phosphonomethyl)-glycine is used in surface modification of cobalt oxide nanoparticle to overcome any toxic effect while functioning as cancer antigen carrier. |
| Definition | ChEBI: A tertiary amino compound that consists of iminodiacetic acid bearing an N-phosphonomethyl substituent. |
| General Description | N-(Phosphonomethyl)iminodiacetic acid hydrate is the hydrated form of N-(phosphonomethyl)iminodiacetic acid (PMIDA; H4pmida). The solubility of PMIDA in various solvents and solvent mixtures has been studied. It is the starting material for the synthesis of N-(phosphonomethyl)iminodiacetate (pmida4-), a multidentate organic ligand. PMIDA undergoes molecular oxygen oxidation in the presence of metal salts to form N-(phosphonomethyl)glycine, also known as glyphosate. H4pmida forms the structural unit of various three-dimensional inorganic-organic hybrid compounds. |
N-(Carboxymethyl)-N-(phosphonomethyl)-glycine Preparation Products And Raw materials
| Raw materials | IMINODIACETIC ACID DISODIUM SALT HYDRATE-->Diethylamine hydrochloride |
| Preparation Products | Glyphosate-->GLYPHOSATE-N-METHYL-->Formaldehyde |
