Introduction：Basic information about N-BENZOYL-DL-ALANINE CAS 1205-02-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-BENZOYL-DL-ALANINE Basic information
| Product Name: | N-BENZOYL-DL-ALANINE |
| Synonyms: | 2-(BENZOYLAMINO)PROPANOIC ACID;BENZOYL-DL-ALANINE;DL-N-BENZOYLALANINE;BZ-DL-ALA-OH;IFLAB-BB F1924-0021;Benzoylalanine;DL-N-BENZOYL-ALPHA-ALANINE;DL-Benzoylalanine |
| CAS: | 1205-02-3 |
| MF: | C10H11NO3 |
| MW: | 193.2 |
| EINECS: | 214-879-5 |
| Product Categories: | |
| Mol File: | 1205-02-3.mol |
|
N-BENZOYL-DL-ALANINE Chemical Properties
| Melting point | 165-167°C |
| Boiling point | 329.41°C (rough estimate) |
| density | 1.2307 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.86±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Very slightly soluble in water. |
| BRN | 3201778 |
| InChI | InChI=1S/C10H11NO3/c1-7(10(13)14)11-9(12)8-5-3-2-4-6-8/h2-7H,1H3,(H,11,12)(H,13,14)/t7-/m0/s1 |
| InChIKey | UAQVHNZEONHPQG-ZETCQYMHSA-N |
| SMILES | C(O)(=O)[C@H](C)NC(=O)C1=CC=CC=C1 |
| CAS DataBase Reference | 1205-02-3(CAS DataBase Reference) |
| EPA Substance Registry System | Alanine, N-benzoyl- (1205-02-3) |
Safety Information
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |
N-BENZOYL-DL-ALANINE Usage And Synthesis
| Uses | N-Benzoyl-DL-alanine is used as pharmaceutical intermediate. |
| Definition | ChEBI: An N-acylamino acid that is the N-benzoyl derivative of alanine. |
| Synthesis Reference(s) | Tetrahedron Letters, 17, p. 2205, 1976 DOI: 10.1016/0040-4039(76)80029-9 |
N-BENZOYL-DL-ALANINE Preparation Products And Raw materials
| Preparation Products | N-[1-[bis(2-chloroethyl)carbamoyl]ethyl]benzamide |
