Introduction:Basic information about N-Cyano-N-[2-(5-methylimidazole-4-methylthio)ethyl]-S-methyl isothiourea CAS 52378-40-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-Cyano-N-[2-(5-methylimidazole-4-methylthio)ethyl]-S-methyl isothiourea Basic information
| Product Name: | N-Cyano-N-[2-(5-methylimidazole-4-methylthio)ethyl]-S-methyl isothiourea |
| Synonyms: | N-Cyano-S-methyl-N''-[2-(4-methyl-5-imidazolyl)-methylthioethyl]- isothioure;2-Methyl-1-cyano-3-[2-[[(5-methyl-1H-imidazol-4-yl)methyl]thio]ethyl]isothiourea;N1-[2-[(5-Methyl-1H-imidazole-4-yl)methylthio]ethyl]-N2-cyano(methylthio)methanamidine;Einecs 257-889-5;N-Cyano-N-[2-(5-MethyliMidazole-4-Methylthio)ethyl]-S-Methyl isothiourea Monohydrate;N-Cyano-N'-[2-[(4-methyl-5-imidazolyl)methylthio]ethyl]-S-methylisothiourea;N-Cyano-N'-[2-[[(5-methyl-4-imidazolyl)methyl]thio]ethyl]-S-methylisothiourea;S-Methyl-N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylthio]ethyl]isothiourea |
| CAS: | 52378-40-2 |
| MF: | C10H15N5S2 |
| MW: | 269.39 |
| EINECS: | 257-889-5 |
| Product Categories: | |
| Mol File: | 52378-40-2.mol |
|
N-Cyano-N-[2-(5-methylimidazole-4-methylthio)ethyl]-S-methyl isothiourea Chemical Properties
| Melting point | 148-150℃ |
| Boiling point | 501.5±60.0 °C(Predicted) |
| density | 1.29±0.1 g/cm3(Predicted) |
| storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.11±0.10(Predicted) |
| color | Yellow |
| Stability: | Light Sensitive |
| Major Application | pharmaceutical |
| InChI | 1S/C10H15N5S2/c1-8-9(15-7-14-8)5-17-4-3-12-10(16-2)13-6-11/h7H,3-5H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | WSUNDBVVUCLXTG-UHFFFAOYSA-N |
| SMILES | S(CCN=C(SC)NC#N)Cc1[nH]cnc1C |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
N-Cyano-N-[2-(5-methylimidazole-4-methylthio)ethyl]-S-methyl isothiourea Usage And Synthesis
| Uses | N-Cyano-N’-[2-[(4-methyl-5-imidazolyl)methylthio]ethyl]-S-methylisothiourea (Cimetidine EP Impurity A) is a Cimetidine (C441650) related impurity. Cimetidine (C441650), a competitive histamine H2-receptor antagonist which inhibits gastric acid secretion and reduces pepsin output. Also used in the preparation of histamine H2 receptor antagonists. |
N-Cyano-N-[2-(5-methylimidazole-4-methylthio)ethyl]-S-methyl isothiourea Preparation Products And Raw materials