Introduction：Basic information about N-PENTANE-D12 CAS 2031-90-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-PENTANE-D12 Basic information
| Product Name: | N-PENTANE-D12 |
| Synonyms: | N-PENTANE-D12;PENTANE-D12;PENTANE-D12, 98 ATOM % D;n-Pentane-d12(Isotopic);n-Pentane-d12,isotopic;n-Pentane-d12, 98%(Isotopic);n-Pentane-d12, 98%(Isotopic);Pentane-d12 |
| CAS: | 2031-90-5 |
| MF: | C5D12 |
| MW: | 84.22 |
| EINECS: | 680-426-7 |
| Product Categories: | Alphabetical Listings;NMR - SolventsStable Isotopes;NMR Solvents and Reagents;NMRStable Isotopes;P;Stable Isotopes;Additional NMR Solvents;Aldrich High Purity NMR Solvents for Routine NMR;Alphabetical Listings;High Throughput NMR;Labware;NMR;NMR Solvents;NMR Solvents and Reagents;Routine NMR;Solvent by Application;Solvents;Solvents for High Throughput NMR;Spectroscopy Solvents (IR;Stable Isotopes;Tubes and Accessories;UV/Vis) |
| Mol File: | 2031-90-5.mol |
|
N-PENTANE-D12 Chemical Properties
| Melting point | −130 °C(lit.) |
| Boiling point | 36 °C(lit.) |
| density | 0.731 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.358(lit.) |
| Fp | <−30 °F |
| solubility | Chloroform (Sparingly), Hexane (Slightly) |
| form | Liquid |
| Sensitive | Light Sensitive |
| Stability: | Volatile |
| InChI | 1S/C5H12/c1-3-5-4-2/h3-5H2,1-2H3/i1D3,2D3,3D2,4D2,5D2 |
| InChIKey | OFBQJSOFQDEBGM-HYVJACIRSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| CAS DataBase Reference | 2031-90-5 |
| CAS Number Unlabeled | 109-66-0 |
Safety Information
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 9-16-29-33 |
| RIDADR | UN 1265 3/PG 2 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Asp. Tox. 1
Flam. Liq. 2
STOT SE 3 |
N-PENTANE-D12 Usage And Synthesis
| Uses | Pentane-d12 is a deuterated NMR solvent useful in NMR-based research and analyses. |
| General Description | Pentane-d12 is a deuterated NMR solvent useful in NMR-based research and analyses. |
N-PENTANE-D12 Preparation Products And Raw materials
