Introduction：Basic information about Octyl 4-methoxycinnamate CAS 5466-77-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Octyl 4-methoxycinnamate Basic information
| Product Name: | Octyl 4-methoxycinnamate |
| Synonyms: | 2-ETHYLHEXYL TRANS-4-METHOXYCINNAMATE;2-ETHYLHEXYL P-METHOXYCINNAMATE;2-ETHYLHEXYL 4-METHOXYCINNAMATE;4-METHOXYCINNAMIC ACID OCTYL ESTER;4-METHOXYCINNAMIC ACID 2-ETHYLHEXYL ESTER;(5-METHYLHEPTYL) 3-(4-METHOXYPHENYL)-2-PROPENOATE;2-Ethylhex-1-yl 3-(4-methoxyphenyl)prop-2-enoate, 2-Ethylhex-1-yl 3-(4-methoxyphenyl)acrylate;2-Ethylhex-1-yl 4-methoxycinnamate |
| CAS: | 5466-77-3 |
| MF: | C18H26O3 |
| MW: | 290.4 |
| EINECS: | 226-775-7 |
| Product Categories: | pharm intermediate;Building Blocks;C12 to C63;Carbonyl Compounds;Chemical Synthesis;Esters;Organic Building Blocks;cosmetic raw material;UV-Absorber;5466-77-3;bc0001;1 |
| Mol File: | 5466-77-3.mol |
|
Octyl 4-methoxycinnamate Chemical Properties
| Melting point | <-25℃ |
| Boiling point | 198-200°C |
| density | 1.009 |
| refractive index | 1.543-1.547 |
| Fp | 193°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to yellow |
| Odor | Odorless |
| Water Solubility | <0.1 g/100 mL at 27 ºC |
| BRN | 5946632 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | UV ABSORBER
UV FILTER
LIGHT STABILIZER |
| InChI | 1S/C18H26O3/c1-4-6-7-15(5-2)14-21-18(19)13-10-16-8-11-17(20-3)12-9-16/h8-13,15H,4-7,14H2,1-3H3/b13-10+ |
| InChIKey | YBGZDTIWKVFICR-JLHYYAGUSA-N |
| SMILES | CCCCC(CC)COC(=O)\C=C\c1ccc(OC)cc1 |
| LogP | 5.921 (est) |
| CAS DataBase Reference | 5466-77-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester(5466-77-3) |
| EPA Substance Registry System | 2-Ethylhexyl p-methoxycinnamate (5466-77-3) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | nwg |
| RTECS | UD3392732 |
| TSCA | TSCA listed |
| HS Code | 29189090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 4 |
| Hazardous Substances Data | 5466-77-3(Hazardous Substances Data) |
Octyl 4-methoxycinnamate Usage And Synthesis
| Chemical Properties | colourless or pale yellow liquid |
| Uses | 2-Ethylhexyl 4-Methoxycinnamate is an UV induced cyclobutane pyrimidine dimer (CDP) formation inhibitior. |
| Uses | octinoxate is the drug name for the sunscreen chemical generally known as octyl methoxycinnamate and ethylhexyl methoxycinnamate. |
| Uses | 2-Ethylhexyl-4-methoxy-cinnamate is used as UV-B-absorbing agent in sunscreens and cosmetic creams, lotions, lipsticks, sun oils, etc. |
| Definition | ChEBI: Octyl 4-methoxycinnamic acid is a cinnamate ester. |
| Brand name | Parsol (Roche); Neo Heliopan (H & R Florasynth); Escalol (ISP Van Dyk) Note—The International Cosmetic Ingredient (INCI) name for octinoxate is octyl methoxycinnamate. |
| General Description | Colorless to pale yellow viscous liquid. |
| Air & Water Reactions | Insoluble in water. |
| Fire Hazard | Flash point data for Octyl 4-methoxycinnamate are not available, however, Octyl 4-methoxycinnamate is probably combustible. |
Octyl 4-methoxycinnamate Preparation Products And Raw materials
| Raw materials | p-Anisaldehyde-->PARA TOLUENE |
