Introduction：Basic information about Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- CAS 2085325-19-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- Basic information
| Product Name: | Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- |
| Synonyms: | Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl-;Phenanthro[3,4-d]oxazole, 10-chloro-2-p;10-chloro-2-phenylphenanthrene [3, 4-d] azole |
| CAS: | 2085325-19-3 |
| MF: | C21H12ClNO |
| MW: | 329.78 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 2085325-19-3.mol |
|
Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- Chemical Properties
| Boiling point | 513.1±23.0 °C(Predicted) |
| density | 1.345±0.06 g/cm3(Predicted) |
| pka | -0.21±0.30(Predicted) |
| InChI | InChI=1S/C21H12ClNO/c22-16-10-8-13-6-7-14-9-11-18-20(19(14)17(13)12-16)24-21(23-18)15-4-2-1-3-5-15/h1-12H |
| InChIKey | OVSSHXQZHDRKMG-UHFFFAOYSA-N |
| SMILES | O1C2=C3C(=CC=C2N=C1C1=CC=CC=C1)C=CC1C3=CC(Cl)=CC=1 |
Safety Information
Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- Usage And Synthesis
Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- Preparation Products And Raw materials
