Introduction:Basic information about Pigment Blue 61 CAS 1324-76-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Pigment Blue 61 Basic information
| Product Name: | Pigment Blue 61 |
| Synonyms: | adien-1-ylidene)methyl)phenyl)amino)-;reflexblueagm;ReflexbluepasteAG;reflexbluer;ACID BLUE 119;ALKALI BLUE;ALKALI BLUE 5B;LABOTEST-BB LT01138527 |
| CAS: | 1324-76-1 |
| MF: | C37H29N3O3S |
| MW: | 595.71 |
| EINECS: | 215-385-2 |
| Product Categories: | Indicator Solutions;Indicators;Titration;Organics |
| Mol File: | 1324-76-1.mol |
|
Pigment Blue 61 Chemical Properties
| density | 1.3[at 20℃] |
| Fp | 6 °C |
| storage temp. | Store at +5°C to +30°C. |
| form | solid |
| color | Brownish black powder |
| PH Range | 9.4(violet)-14(pink) |
| Water Solubility | 2.5μg/L at 25℃ |
| λmax | 597-602 nm in ethanol |
| InChIKey | DVPLSZDCYOJSOG-UHFFFAOYSA-N |
| SMILES | [S](=O)(=O)([O-])c1c(cccc1)[N+H]=C2C=CC(=C(c5ccc(cc5)Nc6ccccc6)c3ccc(cc3)Nc4ccccc4)C=C2 |
| LogP | 3.98 at 25℃ |
| CAS DataBase Reference | 1324-76-1(CAS DataBase Reference) |
| EPA Substance Registry System | C.I. Pigment Blue 61 (1324-76-1) |
Safety Information
| Hazard Codes | F,Xn,Xi |
| Risk Statements | 11-38-48/20-63-65-67-36/37/38 |
| Safety Statements | 36/37-62-36-26 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | WGK 1 slightly water endangering |
| TSCA | TSCA listed |
| HS Code | 3204 12 00 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 1324-76-1(Hazardous Substances Data) |
Pigment Blue 61 Usage And Synthesis
| Uses | Acid Blue 119 is an organic dye used in toner transfer-?type electrophotography and insulating materials for urban telecommunication cables. |
| General Description | indicator |
| Flammability and Explosibility | Non flammable |
| Properties and Applications | | TEST ITEMS | SPECIFICATION | | APPEARANCE | BLUE POWDER | | SHADE | REDDISH | | HEAT RESISTANCE | - | | LIGHT FASTNESS | 7-8 | | ACID RESISTANCE | 5 | | ALKALI RESISTANCE | 5 | | FASTNESS TO BLEEDING | 5 | | OIL ABSORPTION | 40-50% | | SPECIFIC SURFACE | - | | DENSITY | 1.60 g/cm 3 | | RESIDUE ON 80 MESH | - | | WATER SOLUBLE | 1.0% max | | VOLATITE 105 °C | - | | TINTING STRENGTH | 100-105 % | |
Pigment Blue 61 Preparation Products And Raw materials
| Raw materials | OPAL BLUE SS |