Introduction：Basic information about Pigment Orange 5 CAS 3468-63-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Pigment Orange 5 Basic information
| Product Name: | Pigment Orange 5 |
| Synonyms: | lutetiafastoranger;monolitefastorange2r;permanentorangegg;permanentorangehd;PermanentorangeRN;permanentorangetonerra-5650;permanentredgg;permansaorange |
| CAS: | 3468-63-1 |
| MF: | C16H10N4O5 |
| MW: | 338.27 |
| EINECS: | 222-429-4 |
| Product Categories: | Dyes and Pigments;Organics |
| Mol File: | 3468-63-1.mol |
|
Pigment Orange 5 Chemical Properties
| Melting point | 306°C(lit.) |
| Boiling point | 474.44°C (rough estimate) |
| density | 1.3138 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | Amber Vial, -20°C Freezer |
| solubility | Chloroform (Very Slightly), Tetrahydrofuran (Slightly, Heated) |
| pka | 13.45±0.50(Predicted) |
| Colour Index | 12075 |
| form | Solid |
| color | Orange to Dark Red |
| BRN | 964718 |
| Major Application | cleaning products
cosmetics
food and beverages
personal care |
| Cosmetics Ingredients Functions | COLORANT |
| InChI | 1S/C16H10N4O5/c21-15-8-5-10-3-1-2-4-12(10)16(15)18-17-13-7-6-11(19(22)23)9-14(13)20(24)25/h1-9,21H/b18-17+ |
| InChIKey | HBHZKFOUIUMKHV-ISLYRVAYSA-N |
| SMILES | Oc1ccc2ccccc2c1\N=N\c3ccc(cc3[N+]([O-])=O)[N+]([O-])=O |
| LogP | 3.610 (est) |
| CAS DataBase Reference | 3468-63-1(CAS DataBase Reference) |
| EPA Substance Registry System | C.I. Pigment Orange 5 (3468-63-1) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 10-68-40-36 |
| Safety Statements | 16-36/37-26 |
| RIDADR | 1325 |
| WGK Germany | 3 |
| RTECS | QL3854000 |
| TSCA | TSCA listed |
| HS Code | 32041700 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2
Muta. 2 |
| Hazardous Substances Data | 3468-63-1(Hazardous Substances Data) |
Pigment Orange 5 Usage And Synthesis
| Uses | Permanent Orange (cas# 3468-63-1) is a useful research chemical. Dyes and metabolites, Environmental Testing. |
| General Description | Pigment orange 5 is an azo pigment, which can be produced industrially by a diazotization and coupling sequence in which diazotized dinitroaniline is coupled into β-naphthol. |
| Properties and Applications | | TEST ITEMS | SPECIFICATION | | APPEARANCE | ORANGE POWDER | | SHADE | YELLOWISH | | HEAT RESISTANCE | 140 °C min | | LIGHT FASTNESS | 7 | | ACID RESISTANCE | 5 | | ALKALI RESISTANCE | 5 | | FASTNESS TO BLEEDING | 5 | | OIL ABSORPTION | 35-40% | | SPECIFIC SURFACE | 30 m 2 /g | | DENSITY | 1.50 g/cm 3 | | RESIDUE ON 80 MESH | 5.0% max | | WATER SOLUBLE | 1.0% max | | VOLATITE 105 °C | 1.0% max | | TINTING STRENGTH | 100-105 % | |
Pigment Orange 5 Preparation Products And Raw materials
| Raw materials | Sodium hydroxide-->Hydrochloric acid-->Sulfuric acid-->Sodium nitrite-->FUMING SULFURIC ACID-->2-Naphthol-->2,4-Dinitroaniline |
