Introduction：Basic information about Piperonyl chloride CAS 20850-43-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Piperonyl chloride Basic information
| Product Name: | Piperonyl chloride |
| Synonyms: | Piperonyl Chloride (~75% by weight in CH2Cl2);5-(CHLOROMETHYL)-2H-1,3-BENZODIOXOLE;5-(Chloromethyl)-1,3-benzodioxol;Piperonyl chloride(50% by weight in dichloromethane or dichloroethane);TIMTEC-BB SBB005588;PIPERONYL CHLORIDE;1,3-BENZODIOXOLE, 5-(CHLOROMETHYL)-;5-(CHLOROMETHYL)-1,3-BENZODIOXOLE |
| CAS: | 20850-43-5 |
| MF: | C8H7ClO2 |
| MW: | 170.59 |
| EINECS: | 244-081-2 |
| Product Categories: | |
| Mol File: | 20850-43-5.mol |
|
Piperonyl chloride Chemical Properties
| Melting point | 20.5°C |
| Boiling point | 97-100°C 1mm |
| density | 1.32 |
| refractive index | 1.5660 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform, Methanol |
| form | Clear Yellow Solution |
| Sensitive | Moisture Sensitive/Lachrymatory |
| InChI | InChI=1S/C8H7ClO2/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-3H,4-5H2 |
| InChIKey | DWSUJONSJJTODA-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(CCl)C=C2OC1 |
| CAS DataBase Reference | 20850-43-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Methylenedioxybenzyl chloride(20850-43-5) |
| EPA Substance Registry System | 1,3-Benzodioxole, 5-(chloromethyl)- (20850-43-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN1593 |
| Hazard Note | Irritant/Lachrymatory/Moisture Sensitive |
| TSCA | TSCA listed |
| HazardClass | IRRITANT, MOISTURE SENSITIVE, LACHRYMATOR |
| HS Code | 2932990090 |
Piperonyl chloride Usage And Synthesis
| Chemical Properties | Clear Yellow Solution |
| Uses | Piperonyl Chloride is used as a reagent in the synthesis of anti-proliferative hydroxyguanidine compounds. |
| Synthesis Reference(s) | Journal of Medicinal Chemistry, 16, p. 869, 1973 DOI: 10.1021/jm00266a001 |
Piperonyl chloride Preparation Products And Raw materials
| Raw materials | Catechol-->1,3-Benzodioxole-->1,3,5-trioxane |
| Preparation Products | PIPERONYL ACETATE-->2-[4-(1,3-Benzodioxol-5-ylmethyl)piperazin-1-yl]pyrimidine-->5-BROMO-6-(CHLOROMETHYL)-1,3-BENZODIOXOLE |
