Introduction:Basic information about Potassium L-aspartate CAS 14007-45-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Potassium L-aspartate Basic information
| Product Name: | Potassium L-aspartate |
| Synonyms: | asparak;asparticacidpotassiumsalt;k-flebo;Potassium L-Aspartatein stock GMP Factory;Dipotassium L-aspartate;potassiumsalt,l-asparticaci;POTASSIUM L-ASPARTATE;POTASSIUM ASPARTATE |
| CAS: | 14007-45-5 |
| MF: | C4H8KNO4 |
| MW: | 173.21 |
| EINECS: | 237-814-2 |
| Product Categories: | Amino acid salt |
| Mol File: | 14007-45-5.mol |
|
Potassium L-aspartate Chemical Properties
| Cosmetics Ingredients Functions | HAIR CONDITIONING SKIN CONDITIONING |
| InChI | InChI=1/C4H7NO4.K.H/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;/t2-;;/s3 |
| InChIKey | YRFCTCJSFYQKGC-NKCUBJMXNA-N |
| SMILES | [C@@H](N)(C(=O)O)CC(=O)O.[KH] |&1:0,r| |
| LogP | -0.669 (est) |
| CAS DataBase Reference | 14007-45-5(CAS DataBase Reference) |
| EPA Substance Registry System | L-Aspartic acid, potassium salt (14007-45-5) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | CI9479000 |
| F | 3 |
| TSCA | TSCA listed |
| Toxicity | rat,LD50,intravenous,667mg/kg (667mg/kg),Drugs in Japan Vol. 6, Pg. 11, 1982. |
Potassium L-aspartate Usage And Synthesis
| Description | Potassium l-aspartate, or simply potassium aspartate, is a safe and bioavailable source of potassium. It is an ionic salt form of potassium combined with l-aspartic acid. Potassium is an essential mineral that prevents muscle cramps by acting as an electrolyte and maintaining fluid levels inside cells. It is also a vasodilator that supports heart health. The most well-known potassium-rich food is the banana, but butternut squash, potatoes, spinach, and broccoli are good dietary potassium sources, too. |
Potassium L-aspartate Preparation Products And Raw materials