Introduction:Basic information about CAS 1028-40-6|4(1H)-Quinazolinone,3-(4-chlorophenyl)-2,3-dihydro-2-thioxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4(1H)-Quinazolinone,3-(4-chlorophenyl)-2,3-dihydro-2-thioxo- |
|---|
| CAS Number | 1028-40-6 | Molecular Weight | 288.75200 |
|---|
| Density | 1.5g/cm3 | Boiling Point | 457.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H9ClN2OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.4ºC |
|---|
Names
| Name | 3-(4-chlorophenyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5g/cm3 |
|---|
| Boiling Point | 457.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H9ClN2OS |
|---|
| Molecular Weight | 288.75200 |
|---|
| Flash Point | 230.4ºC |
|---|
| Exact Mass | 288.01200 |
|---|
| PSA | 73.69000 |
|---|
| LogP | 3.32780 |
|---|
| Vapour Pressure | 1.5E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.753 |
|---|
| InChIKey | FSBMFWYJFRHAIW-UHFFFAOYSA-N |
|---|
| SMILES | O=c1c2ccccc2[nH]c(=S)n1-c1ccc(Cl)cc1 |
|---|
Synonyms
| 3-(4-chloro-phenyl)-2-mercapto-3h-quinazolin-4-one |
| 3-(4-chlorophenyl)-2-thioxo-2,3-dihydroquinazolin-4(1H)-one |
| 3-(4-Chlorophenyl)-2-thioxo-2,3-dihydro-4(1H)-quinazolinone |
| 3-(4-chlorophenyl)-2-sulfanyl-3-hydroquinazolin-4-one |
| 3-(4-chlorophenyl)-2-thio-1H,3H-quinazolin-4-one |
| 3-(4-chlorophenyl)-2,3-dihydro-2-thioxoquinazolin-4(1H)-one |
| 3-N-p-chlorophenylquinazoline-2-thione-4-one |
| 3-(4-chlorophenyl)-2-thioxo-2,3-dihydro-1H-quinazolin-4-one |
| 3-p-chlorophenyl-4-oxoquinazoline-2-thione |
| 3-(4-chlorophenyl)-2-thioxo-1,2-dihydro-4(3H)-quinazolinone |