Introduction：Basic information about CAS 29638-71-9|3-(3-Phenyl-2-propenyl)-2,4-pentanedione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(3-Phenyl-2-propenyl)-2,4-pentanedione |
|---|
| CAS Number | 29638-71-9 | Molecular Weight | 216.27600 |
|---|
| Density | 1.042g/cm3 | Boiling Point | 160-164ºC 3mm |
|---|
| Molecular Formula | C14H16O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 145.6ºC |
|---|
Names
| Name | 3-(3-Phenyl-2-propenyl)-2,4-pentanedione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.042g/cm3 |
|---|
| Boiling Point | 160-164ºC 3mm |
|---|
| Molecular Formula | C14H16O2 |
|---|
| Molecular Weight | 216.27600 |
|---|
| Flash Point | 145.6ºC |
|---|
| Exact Mass | 216.11500 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 2.88410 |
|---|
| Vapour Pressure | 3.07E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | PGEPOVPAPVUGAJ-RMKNXTFCSA-N |
|---|
| SMILES | CC(=O)C(CC=Cc1ccccc1)C(C)=O |
|---|
Safety Information
Customs
| HS Code | 2914190090 |
|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 3-cinnamylpentane-2,4-dione |
| (phenyl-3 propene-2yl)-3 pentane dione-2,4 |
| 3-(3-phenylallyl)pentane-2,4-dione |
| trans-3-cinnamylpentane-2,4-dione |
