Introduction：Basic information about CAS 23893-84-7|1,3-Isobenzofurandione,5,6-dibromohexahydro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Isobenzofurandione,5,6-dibromohexahydro- |
|---|
| CAS Number | 23893-84-7 | Molecular Weight | 311.95500 |
|---|
| Density | 2.032g/cm3 | Boiling Point | 408.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H8Br2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 200.8ºC |
|---|
Names
| Name | 5,6-dibromo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.032g/cm3 |
|---|
| Boiling Point | 408.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H8Br2O3 |
|---|
| Molecular Weight | 311.95500 |
|---|
| Flash Point | 200.8ºC |
|---|
| Exact Mass | 309.88400 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 1.62300 |
|---|
| Vapour Pressure | 7.05E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | MTFOVFKEUAKPNY-UHFFFAOYSA-N |
|---|
| SMILES | O=C1OC(=O)C2CC(Br)C(Br)CC12 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| trans-4,5-Dibromo-cis-cyclohexanedicarboxylic anhydride |
| (+-)-4c,5t-dibromo-cyclohexane-1c,2c-dicarboxylic acid-anhydride |
| (+-)-4c,5t-Dibrom-cyclohexan-1c,2c-dicarbonsaeure-anhydrid |
| 5,6-dibromohexahydro-2-benzofuran-1,3-dione |
| trans-4,5-Dibromocyclohexane-cis-1,2-dicarboxylic acid anhydride |
