Introduction:Basic information about CAS 107027-38-3|2-(2-Chlorophenyl)-8-methylquinoline-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-Chlorophenyl)-8-methylquinoline-4-carboxylic acid |
|---|
| CAS Number | 107027-38-3 | Molecular Weight | 297.73600 |
|---|
| Density | 1.336g/cm3 | Boiling Point | 476.9ºC at 760 mmHg |
|---|
| Molecular Formula | C17H12ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 242.2ºC |
|---|
Names
| Name | 2-(2-Chlorophenyl)-8-methylquinoline-4-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.336g/cm3 |
|---|
| Boiling Point | 476.9ºC at 760 mmHg |
|---|
| Molecular Formula | C17H12ClNO2 |
|---|
| Molecular Weight | 297.73600 |
|---|
| Flash Point | 242.2ºC |
|---|
| Exact Mass | 297.05600 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 4.56180 |
|---|
| Vapour Pressure | 6.69E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.672 |
|---|
| InChIKey | KQICKYYIRMWRJY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc2c(C(=O)O)cc(-c3ccccc3Cl)nc12 |
|---|