Introduction:Basic information about CAS 22952-43-8|3-Chloro-4-methoxybenzene-1-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Chloro-4-methoxybenzene-1-sulfonyl chloride |
|---|
| CAS Number | 22952-43-8 | Molecular Weight | 241.09200 |
|---|
| Density | 1.488g/cm3 | Boiling Point | 352.163ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6Cl2O3S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 166.782ºC |
|---|
Names
| Name | 3-Chloro-4-methoxybenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.488g/cm3 |
|---|
| Boiling Point | 352.163ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6Cl2O3S |
|---|
| Molecular Weight | 241.09200 |
|---|
| Flash Point | 166.782ºC |
|---|
| Exact Mass | 239.94100 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 3.35690 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | UMTPXDWZAKJPNY-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(S(=O)(=O)Cl)cc1Cl |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3-Chlor-4-methoxy-benzolsulfochlorid |
| Benzenesulfonyl chloride,3-chloro-4-methoxy |
| 3-Chloro-4-methoxybenzene-1-sulfonyl chloride |
| 3-chloro-4-methoxy-benzenesulfonyl chloride |
| 3-chloro-4-methoxybezenesulfonyl chloride |
| 3-Chlor-4-methoxy-benzolsulfonylchlorid |