Introduction：Basic information about CAS 69898-40-4|3-(1-Ethyl-2-methylindol-3-yl)-3-(2-ethoxy-4-diethylaminophenyl)-4-azaphthalid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(1-Ethyl-2-methylindol-3-yl)-3-(2-ethoxy-4-diethylaminophenyl)-4-azaphthalide |
|---|
| CAS Number | 69898-40-4 | Molecular Weight | 483.60100 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 669.1ºC at 760 mmHg |
|---|
| Molecular Formula | C30H33N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 358.5ºC |
|---|
Names
| Name | 7-[4-(diethylamino)-2-ethoxyphenyl]-7-(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 669.1ºC at 760 mmHg |
|---|
| Molecular Formula | C30H33N3O3 |
|---|
| Molecular Weight | 483.60100 |
|---|
| Flash Point | 358.5ºC |
|---|
| Exact Mass | 483.25200 |
|---|
| PSA | 56.59000 |
|---|
| LogP | 6.07180 |
|---|
| Vapour Pressure | 9.1E-18mmHg at 25°C |
|---|
| Index of Refraction | 1.61 |
|---|
| InChIKey | RCVMSMLWRJESQC-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc(N(CC)CC)ccc1C1(c2c(C)n(CC)c3ccccc23)OC(=O)c2cccnc21 |
|---|
Synonyms
| EINECS 274-194-2 |
| 7-(4-(Diethylamino)-2-ethoxyphenyl)-7-(1-ethyl-2-methyl-1H-indol-3-yl)furo[3,4-b]pyridin-5(7H)-one |
| 3-(4-diethylamino-2-ethoxyphenyl)-3-(1-ethyl-2-methyl-indol-3-yl)-4-azaphthalide |
| 3-(4-diethylamino-2-ethoxyphenyl)-3-(1-ethyl-2-methyl-1H-indol-3-yl)-4-azaphthalide |
| 3-(1-Ethyl-2-methylindol-3-yl)-3-(2-ethoxy-4-diethylaminophenyl)-4-azaphthalide |
