Introduction：Basic information about CAS 37095-43-5|5,10,15,20-Tetrakis(4-fluorophenyl)-21H,23H-porphine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,10,15,20-Tetrakis(4-fluorophenyl)-21H,23H-porphine |
|---|
| CAS Number | 37095-43-5 | Molecular Weight | 686.69800 |
|---|
| Density | 1.354g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C44H26F4N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5,10,15,20-tetrakis(4-fluorophenyl)-21,22-dihydroporphyrin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.354g/cm3 |
|---|
| Molecular Formula | C44H26F4N4 |
|---|
| Molecular Weight | 686.69800 |
|---|
| Exact Mass | 686.20900 |
|---|
| PSA | 56.30000 |
|---|
| LogP | 7.42260 |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | WCSKDPQVNKZNQD-UHFFFAOYSA-N |
|---|
| SMILES | Fc1ccc(-c2c3nc(c(-c4ccc(F)cc4)c4ccc([nH]4)c(-c4ccc(F)cc4)c4nc(c(-c5ccc(F)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
|---|
Safety Information
Synonyms
| 5,10,15,20-tetra(4-fluorophenyl)porphyrin |
| meso-tetra(4-fluorophenyl)porphyrin |
| Tetra-(4-fluorophenyl)porphin |
| 5,10,15,20-tetrakis(4-fluorophenyl)porphyrin |
| meso-tetrakis-(4-fluorophenyl)porphyrin |
| tetrakis(4-fluorophenyl)porphyrin |
| 5,10,15,20-tetrakis(p-fluorophenyl)porphyrin |
| 5,10,15,20-Tetrakis(4-fluorophenyl)-21H,23H-porphine |
