Introduction：Basic information about CAS 284665-11-8|N-Fmoc-Glycine-2,2-D2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Fmoc-Glycine-2,2-D2 |
|---|
| CAS Number | 284665-11-8 | Molecular Weight | 299.318 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 545.7±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H13D2NO4 | Melting Point | 174-175ºC(lit.) |
|---|
| MSDS | USA | Flash Point | 283.8±25.4 °C |
|---|
Names
| Name | 2,2-dideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 545.7±33.0 °C at 760 mmHg |
|---|
| Melting Point | 174-175ºC(lit.) |
|---|
| Molecular Formula | C17H13D2NO4 |
|---|
| Molecular Weight | 299.318 |
|---|
| Flash Point | 283.8±25.4 °C |
|---|
| Exact Mass | 299.112671 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 3.20 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.620 |
|---|
| InChIKey | NDKDFTQNXLHCGO-KNXIQCGSSA-N |
|---|
| SMILES | O=C(O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Glycine-2,2-d, N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-Gly-OH-2,2-d2 |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl](2,2-H)glycine |
| Glycine-2,2-d2,N-Fmoc |
