Introduction：Basic information about CAS 286460-71-7|fmoc-phe-oh, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fmoc-phe-oh |
|---|
| CAS Number | 286460-71-7 | Molecular Weight | 387.42800 |
|---|
| Density | 1.276g/cm3 | Boiling Point | 620.1ºC at 760mmHg |
|---|
| Molecular Formula | C24H21NO4 | Melting Point | 180-187ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 328.8ºC |
|---|
Names
| Name | fmoc-phe-oh |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.276g/cm3 |
|---|
| Boiling Point | 620.1ºC at 760mmHg |
|---|
| Melting Point | 180-187ºC(lit.) |
|---|
| Molecular Formula | C24H21NO4 |
|---|
| Molecular Weight | 387.42800 |
|---|
| Flash Point | 328.8ºC |
|---|
| Exact Mass | 387.14700 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 4.61190 |
|---|
| InChIKey | SJVFAHZPLIXNDH-QFIPXVFZSA-N |
|---|
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Safety Phrases | 22-24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| EINECS 252-661-1 |
| Fmoc-Phe-OH-2-13C |
| MFCD00037128 |
