Introduction：Basic information about CAS 2868-48-6|Hyodeoxycholic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hyodeoxycholic acid methyl ester |
|---|
| CAS Number | 2868-48-6 | Molecular Weight | 406.59900 |
|---|
| Density | 1.089g/cm3 | Boiling Point | 507.6ºC at 760 mmHg |
|---|
| Molecular Formula | C25H42O4 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 162.1ºC |
|---|
Names
| Name | methyl (4R)-4-[(3R,5R,6S,8S,9S,10R,13R,14S,17R)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.089g/cm3 |
|---|
| Boiling Point | 507.6ºC at 760 mmHg |
|---|
| Molecular Formula | C25H42O4 |
|---|
| Molecular Weight | 406.59900 |
|---|
| Flash Point | 162.1ºC |
|---|
| Exact Mass | 406.30800 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 4.56630 |
|---|
| Vapour Pressure | 1.99E-12mmHg at 25°C |
|---|
| Index of Refraction | 8 ° (C=1, EtOH) |
|---|
| InChIKey | BWDRDVHYVJQWBO-KFVVGANVSA-N |
|---|
| SMILES | COC(=O)CCC(C)C1CCC2C3CC(O)C4CC(O)CCC4(C)C3CCC12C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 3|A,6|A-Dihydroxy-5|A-cholan-24-oic acid methyl ester |
| 3alpha,6alpha-Dihydroxy-5beta-cholan-24-oic acid methyl ester |
| MFCD00059509 |
| Hyodeoxycholic acid methyl ester |
| methyl hyodeoxycholanoate |
