Introduction：Basic information about CAS 287484-33-7|fmoc-asp-oh-15n, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fmoc-asp-oh-15n |
|---|
| CAS Number | 287484-33-7 | Molecular Weight | 356.33500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H17NO6 | Melting Point | 190ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | fmoc-asp-oh-15n |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 190ºC(lit.) |
|---|
| Molecular Formula | C19H17NO6 |
|---|
| Molecular Weight | 356.33500 |
|---|
| Exact Mass | 356.10300 |
|---|
| PSA | 112.93000 |
|---|
| LogP | 2.84390 |
|---|
| InChIKey | KSDTXRUIZMTBNV-OICQNXLQSA-N |
|---|
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| MFCD00190514 |
| N-(9-Fluorenylmethoxycarbonyl)-L-aspartic-15N acid L-Aspartic-15N acid,N-Fmoc derivative |
