Introduction:Basic information about CAS 28862-89-7|CBZ-D-Isoleucine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | CBZ-D-Isoleucine |
|---|
| CAS Number | 28862-89-7 | Molecular Weight | 265.305 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 442.8±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.6±26.8 °C |
|---|
Names
| Name | (2R,3R)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 442.8±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H19NO4 |
|---|
| Molecular Weight | 265.305 |
|---|
| Flash Point | 221.6±26.8 °C |
|---|
| Exact Mass | 265.131409 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 3.12 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | JSHXJPFZKBRLFU-ZYHUDNBSSA-N |
|---|
| SMILES | CCC(C)C(NC(=O)OCc1ccccc1)C(=O)O |
|---|
Synonyms
| L-N-benzyloxycarbonylisoleucine |
| N-[(Benzyloxy)carbonyl]-D-isoleucine |
| Cbz-D-Ile-OH |
| N-benzyloxycarbonyl-DL-isoleucine |
| D-Isoleucine, N-[(phenylmethoxy)carbonyl]- |
| Cbz-D-isoleucine |
| N-carbobenzyloxy-L-isoleucine |