Introduction：Basic information about CAS 6027-43-6|aspalathin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | aspalathin |
|---|
| CAS Number | 6027-43-6 | Molecular Weight | 452.40900 |
|---|
| Density | 1.662±0.06 g/cm3 (20ºC 760 Torr) | Boiling Point | / |
|---|
| Molecular Formula | C21H24O11 | Melting Point | 131-165ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3-(3,4-dihydroxyphenyl)-1-[2,4-dihydroxy-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]propan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.662±0.06 g/cm3 (20ºC 760 Torr) |
|---|
| Melting Point | 131-165ºC |
|---|
| Molecular Formula | C21H24O11 |
|---|
| Molecular Weight | 452.40900 |
|---|
| Exact Mass | 452.13200 |
|---|
| PSA | 208.37000 |
|---|
| InChIKey | VCPUQYKWJRESOC-VJXVFPJBSA-N |
|---|
| SMILES | O=C(CCc1ccc(O)c(O)c1)c1c(O)cc(O)c(C2OC(CO)C(O)C(O)C2O)c1O |
|---|
| Storage condition | ?20°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| RTECS | UC1656000 |
|---|
Synonyms
| 2',3,4,4',6'-pentahydroxydihydrochalcone-3'-C-glucoside |
| 3,3',4,4',5-pentachlorobiphenyl |
| aspalathine |
| 1,1'-Biphenyl,2,3,3',4',5'-pentachloro |
| 3'-C-fl-D-glucopyranosyl-2',3,4,4'-6'-pentahydroxydihydrochalcone |
| 2',3,3',4,5-PENTACHLOROBIPHENYL |
| 2,3,3',4',5'-pcb |
