Introduction：Basic information about CAS 60858-95-9|diazald(r)-n-methyl-13c, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diazald(r)-n-methyl-13c |
|---|
| CAS Number | 60858-95-9 | Molecular Weight | 215.23400 |
|---|
| Density | 1.3g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H10N2O3S | Melting Point | 61-62ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS02, GHS07 | Signal Word | Danger |
|---|
Names
| Name | diazald(r)-n-methyl-13c |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Melting Point | 61-62ºC |
|---|
| Molecular Formula | C8H10N2O3S |
|---|
| Molecular Weight | 215.23400 |
|---|
| Exact Mass | 215.04500 |
|---|
| PSA | 75.19000 |
|---|
| LogP | 2.37770 |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | FFKZOUIEAHOBHW-VQEHIDDOSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N(C)N=O)cc1 |
|---|
Safety Information
| Symbol |
GHS02, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H242-H315-H317-H319-H335 |
|---|
| Precautionary Statements | P210-P280-P305 + P351 + P338-P333 + P313-P337 + P313 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R20/21/22;R43 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | UN 2811 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1(b) |
|---|
Synonyms
| p-Tolylsulfonyl-<13C>-methylnitrosoamid |
| diazald-N-methyl-13C |
