Introduction：Basic information about CAS 815586-68-6|5-Fluoro-2-methyl-1H-indole-3-carbaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Fluoro-2-methyl-1H-indole-3-carbaldehyde |
|---|
| CAS Number | 815586-68-6 | Molecular Weight | 177.175 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 347.7±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H8FNO | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 164.1±26.5 °C |
|---|
Names
| Name | 5-Fluoro-2-methyl-1H-indole-3-carbaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 347.7±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H8FNO |
|---|
| Molecular Weight | 177.175 |
|---|
| Flash Point | 164.1±26.5 °C |
|---|
| Exact Mass | 177.058990 |
|---|
| PSA | 32.86000 |
|---|
| LogP | 2.28 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | FISQQNGEDJOACY-UHFFFAOYSA-N |
|---|
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)F)C=O |
|---|
Synonyms
| 1H-Indole-3-carboxaldehyde, 5-fluoro-2-methyl- |
| F3250-0725 |
| 5-Fluoro-2-methyl-1H-indole-3-carbaldehyde |
| 2-methyl-3-formyl-5-fluoroindole |
| 5-Fluoro-2-methylindole-3-carboxaldehyde |
| 2-methyl-5-fluoroindole-3-carboxaldehyde |
| 5-FLUORO-3-FORMYL-2-METHYL-INDOLE |
