Introduction：Basic information about CAS 103-12-8|p-[(2,4-diaminophenyl)azo]benzenesulphonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-[(2,4-diaminophenyl)azo]benzenesulphonamide |
|---|
| CAS Number | 103-12-8 | Molecular Weight | 291.32900 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 601.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H13N5O2S | Melting Point | 249.5°C |
|---|
| MSDS | / | Flash Point | 317.4ºC |
|---|
Names
| Name | prontosil |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 601.2ºC at 760mmHg |
|---|
| Melting Point | 249.5°C |
|---|
| Molecular Formula | C12H13N5O2S |
|---|
| Molecular Weight | 291.32900 |
|---|
| Flash Point | 317.4ºC |
|---|
| Exact Mass | 291.07900 |
|---|
| PSA | 145.30000 |
|---|
| LogP | 4.85730 |
|---|
| Vapour Pressure | 2.06E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.716 |
|---|
| InChIKey | ABBQGOCHXSPKHJ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(N=Nc2ccc(S(N)(=O)=O)cc2)c(N)c1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 4-(2,4-diamino-phenylazo)-benzenesulfonic acid amide |
| 4'-sulfamyl-2,4-diaminoazobenzene |
| Aseptil rojo (TN) |
| 4-[(2,4-diaminophenyl)azo]-benzenesulfonamide |
| 2'.4'-Diamino-azobenzol-sulfonsaeure-(4)-amid |
| streptocide |
| EINECS 203-081-2 |
| Prontosil rubrum |
| Sulfamidochrysoidine |
| p-((2,4-Diaminophenyl)azo)benzenesulphonamide |
| 4-[(2,4-diaminophenyl)diazenyl]benzenesulfonamide |
| 4-(2,4-Diamino-phenylazo)-benzolsulfonsaeure-amid |
| p-[(2,4-diaminophenyl)azo]benzenesulfonamide |
