Introduction:Basic information about CAS 221615-75-4|1-(6-Methylpyridin-3-yl)-2-[4-(methylsulfonyl)phenyl]ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(6-Methylpyridin-3-yl)-2-[4-(methylsulfonyl)phenyl]ethanone |
|---|
| CAS Number | 221615-75-4 | Molecular Weight | 289.349 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 509.7±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H15NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 262.1±30.1 °C |
|---|
Names
| Name | 1-(6-methylpyridin-3-yl)-2-(4-methylsulfonylphenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 509.7±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H15NO3S |
|---|
| Molecular Weight | 289.349 |
|---|
| Flash Point | 262.1±30.1 °C |
|---|
| Exact Mass | 289.077271 |
|---|
| PSA | 72.48000 |
|---|
| LogP | 0.73 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | YBFHILNBYXCJKD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(=O)Cc2ccc(S(C)(=O)=O)cc2)cn1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-(6-methylpyridin-3-yl)-2-[(4-methylsulfonyl)-phenyl]-ethanone |
| 2-(4-methanesulfonyl-phenyl)-1-(6-methyl-pyridin-3-yl)-ethanone |
| 2-(4-MESYLPHENYL)-1-(6-METHYLPYRIDIN-3-YL)-ETHAN-1-ONE |
| 1-(6-methylpyridin-3-yl)-2-[4-(methylsulphonyl)phenyl]ethanone |
| T6NJ B1 EV1R DSW1 |
| Ethanone, 1-(6-methyl-3-pyridinyl)-2-[4-(methylsulfonyl)phenyl]- |
| 1-(6-methyl-3-pyridinyl)-2[4-(methylthio)phenyl]ethanone |
| 1-(6-Methyl-3-pyridinyl)-2-[4-(methylsulfonyl)phenyl]ethanone |
| 1-(6-Methyl-3-pyridyl)-2-(4-methylsulfonylphenyl)ethanone |
| Etoricoxib Impurity 6 |