Introduction:Basic information about CAS 102783-18-6|4,5-diamino-6-hydroxypyrimidine hemisulfate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,5-diamino-6-hydroxypyrimidine hemisulfate |
|---|
| CAS Number | 102783-18-6 | Molecular Weight | 350.31200 |
|---|
| Density | / | Boiling Point | 603.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H14N8O6S | Melting Point | 270ºC (dec.)(lit.) |
|---|
| MSDS | USA | Flash Point | 318.7ºC |
|---|
Names
| Name | 5,6-diamino-1H-pyrimidin-4-one,sulfuric acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 603.4ºC at 760 mmHg |
|---|
| Melting Point | 270ºC (dec.)(lit.) |
|---|
| Molecular Formula | C8H14N8O6S |
|---|
| Molecular Weight | 350.31200 |
|---|
| Flash Point | 318.7ºC |
|---|
| Exact Mass | 350.07600 |
|---|
| PSA | 279.08000 |
|---|
| LogP | 1.44600 |
|---|
| Vapour Pressure | 4.09E-16mmHg at 25°C |
|---|
| InChIKey | SVJZVGHPJPXEJQ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc[nH]c(=O)c1N.Nc1nc[nH]c(=O)c1N.O=S(=O)(O)O |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| Safety Phrases | 22-24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 5,6-Diaminopyrimidin-4(3H)-one sulfate(2:1) |
| 5,6-Diamino-3H-pyrimidin-4-on,Sulfat |
| MFCD00070410 |
| 4,5-Diamino-6-hydroxypyrimidine hemisulphate |
| 4,5-DIAMINO-6-HYDROXYPYRIMIDINE HEMISULFATE |
| 4,5-Diamino-6-hydroxypyrimidine hemisulfate salt |
| 5,6-Diaminopyrimidin-4-ol hemisulphate |
| bis(5,6-diaminopyrimidin-4-ol) |
| 5,6-diamino-3H-pyrimidin-4-one,sulfate |