Introduction：Basic information about CAS 885274-69-1|2-(4-Boc-piperazinyl)-α-(3,5-dimethoxy-phenyl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-Boc-piperazinyl)-α-(3,5-dimethoxy-phenyl)acetic acid |
|---|
| CAS Number | 885274-69-1 | Molecular Weight | 380.43500 |
|---|
| Density | 1.212g/cm3 | Boiling Point | 504.837°C at 760 mmHg |
|---|
| Molecular Formula | C19H28N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 259.116°C |
|---|
Names
| Name | 2-(3,5-dimethoxyphenyl)-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.212g/cm3 |
|---|
| Boiling Point | 504.837°C at 760 mmHg |
|---|
| Molecular Formula | C19H28N2O6 |
|---|
| Molecular Weight | 380.43500 |
|---|
| Flash Point | 259.116°C |
|---|
| Exact Mass | 380.19500 |
|---|
| PSA | 88.54000 |
|---|
| LogP | 2.25800 |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | FUKYCGTTWYIIAR-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(OC)cc(C(C(=O)O)N2CCN(C(=O)OC(C)(C)C)CC2)c1 |
|---|
Synonyms
| 2-(4-Boc-piperazinyl)-α-(3,5-dimethoxy-phenyl)acetic acid |
| (3,5-Dimethoxyphenyl)(4-{[(2-methyl-2-propanyl)oxy]carbonyl}-1-piperazinyl)acetic acid |
